Products 881913-20-8
CAS 881913-20-8 appears in our catalog under these names: Boronic acid, [3-(1-naphthalenyl)phenyl]-, 97%, 3–(naphthalen–1–yl)phenylboronic acid (contains varying amounts of Anhydride), 3-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride), (3-(Naphthalen-1-yl)phenyl)boronic acid 96%, (3-(Naphthalen-1-yl)phenyl)boronic acid, 96%, 96%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 250mg.
(3-naphthalen-1-ylphenyl)boronic acid (CAS 881913-20-8) is a chemical compound with the molecular formula C16H13BO2 and a molecular weight of 248.1 g/mol. IUPAC name: (3-naphthalen-1-ylphenyl)boronic acid. InChIKey: HFXYUCJLQZCNPD-UHFFFAOYSA-N.
| Molecular formula | C16H13BO2 |
|---|---|
| Molecular weight | 248.1 g/mol |
| IUPAC name | (3-naphthalen-1-ylphenyl)boronic acid |
| InChIKey | HFXYUCJLQZCNPD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CC=CC3=CC=CC=C32)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride), (3-(Naphthalen-1-yl)phenyl)boronic acid, 3-(1-naphthyl)phenylboronic acid, (3-Naphthalen-1-ylphenyl)boronic acid, [3-(1-Naphthyl)phenyl]boronic acid, [3-(Naphthalen-1-yl)phenyl]boronic acid, (3-(Naphthalen-1-yl)phenyl)boronic acid;3-(1-naphthalenyl)phenylboronic acid, 3-(1-Naphthyl)benzeneboronic acid, HFXYUCJLQZCNPD-UHFFFAOYSA-N, 3-(1-naphthyl) phenylboronic acid