cas: 1135871-85-0 — see every product listed under this CAS number, including other names
(8-Oxo-5,6,7,8-tetrahydronaphthalen-2-yl)boronic acid, 97% (CAS 1135871-85-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F604019-250MG |
| cas | 1135871-85-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1153.78 Pln | |
| Fluorochem | 1g | 2226.32 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(8-oxo-6,7-dihydro-5H-naphthalen-2-yl)boronic acid (CAS 1135871-85-0) is a chemical compound with the molecular formula C10H11BO3 and a molecular weight of 190.01 g/mol. IUPAC name: (8-oxo-6,7-dihydro-5H-naphthalen-2-yl)boronic acid. InChIKey: SXFJBJJYSFLTMC-UHFFFAOYSA-N.
| Molecular formula | C10H11BO3 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (8-oxo-6,7-dihydro-5H-naphthalen-2-yl)boronic acid |
| InChIKey | SXFJBJJYSFLTMC-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(CCCC2=O)C=C1)(O)O |
Computed by PubChem (NCBI)