CAS 1415920-25-0 is the registry number for (5-Oxo-5,6,7,8-tetrahydronaphthalen-2-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)boronic acid (CAS 1415920-25-0) is a chemical compound with the molecular formula C10H11BO3 and a molecular weight of 190.01 g/mol. IUPAC name: (5-oxo-7,8-dihydro-6H-naphthalen-2-yl)boronic acid. InChIKey: BHDRMPJVTRVJOQ-UHFFFAOYSA-N.
| Molecular formula | C10H11BO3 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (5-oxo-7,8-dihydro-6H-naphthalen-2-yl)boronic acid |
| InChIKey | BHDRMPJVTRVJOQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=O)CCC2)(O)O |
Computed by PubChem (NCBI)