(9-Oxo-9H-fluoren-2-yl)boronic acid, 95%
cas: 2036064-15-8 — see every product listed under this CAS number, including other names
(9-Oxo-9H-fluoren-2-yl)boronic acid, 95% (CAS 2036064-15-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1618029-250mg |
| cas | 2036064-15-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1577.44 Pln | |
| Ambeed | 25g | 5321.00 Pln | |
| BLDpharm | 250mg | 231.05 Pln | |
| BLDpharm | 1g | 480.97 Pln | |
| BLDpharm | 5g | 1547.26 Pln | |
| BLDpharm | 25g | 5218.19 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 1514.00 Pln | |
| Chemat | 25g | 5128.40 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 883.04 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(9-oxofluoren-2-yl)boronic acid (CAS 2036064-15-8) is a chemical compound with the molecular formula C13H9BO3 and a molecular weight of 224.02 g/mol. IUPAC name: (9-oxofluoren-2-yl)boronic acid. InChIKey: PPBIDUFOTADKNY-UHFFFAOYSA-N.
| Molecular formula | C13H9BO3 |
|---|---|
| Molecular weight | 224.02 g/mol |
| IUPAC name | (9-oxofluoren-2-yl)boronic acid |
| InChIKey | PPBIDUFOTADKNY-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3C2=O)(O)O |
Computed by PubChem (NCBI)