CAS 2036064-15-8 appears in our catalog under these names: (9-Oxo-9H-fluoren-2-yl)boronic acid, (9-Oxo-9H-fluoren-2-yl)boronic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
(9-oxofluoren-2-yl)boronic acid (CAS 2036064-15-8) is a chemical compound with the molecular formula C13H9BO3 and a molecular weight of 224.02 g/mol. IUPAC name: (9-oxofluoren-2-yl)boronic acid. InChIKey: PPBIDUFOTADKNY-UHFFFAOYSA-N.
| Molecular formula | C13H9BO3 |
|---|---|
| Molecular weight | 224.02 g/mol |
| IUPAC name | (9-oxofluoren-2-yl)boronic acid |
| InChIKey | PPBIDUFOTADKNY-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C3=CC=CC=C3C2=O)(O)O |
Computed by PubChem (NCBI)