(9E,12E)-OCTADECA-9,12-DIENOIC ACID, 98%
cas: 506-21-8 — see every product listed under this CAS number, including other names
(9E,12E)-OCTADECA-9,12-DIENOIC ACID, 98% (CAS 506-21-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F809612-5G |
| cas | 506-21-8 |
| size | 5g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 10973.24 Pln | |
| Chemat | 50mg | 222.80 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1566.80 Pln | |
| Chemat | 5g | 5176.40 Pln | |
| BLDpharm | 50mg | 308.80 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 1014.11 Pln | |
| BLDpharm | 1g | 2124.83 Pln | |
| BLDpharm | 5g | 8283.77 Pln | |
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 1g | 2028.47 Pln | |
| Fluorochem | 50mg | 242.64 Pln | |
| Fluorochem | 100mg | 430.07 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Linoelaidic acid is an octadecadienoic acid containing two E (trans) double bonds at positions 9 and 12. It has a role as a metabolite. It is an octadecadienoic acid and an omega-6 fatty acid.
Source: ChEBI
| Molecular formula | C18H32O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | (9E,12E)-octadeca-9,12-dienoic acid |
| InChIKey | OYHQOLUKZRVURQ-AVQMFFATSA-N |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)O |
Computed by PubChem (NCBI)