CAS 79050-23-0 appears in our catalog under these names: Linoleic Acid–d4, Linoleic acid-d4, 99.79%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 500 μg (17.58 mM * 99.98 μL in Methyl acetate).
(9Z,12Z)-9,10,12,13-tetradeuteriooctadeca-9,12-dienoic acid (CAS 79050-23-0) is a chemical compound with the molecular formula C18H32O2 and a molecular weight of 284.5 g/mol. IUPAC name: (9Z,12Z)-9,10,12,13-tetradeuteriooctadeca-9,12-dienoic acid. InChIKey: OYHQOLUKZRVURQ-GPTDOFLBSA-N.
| Molecular formula | C18H32O2 |
|---|---|
| Molecular weight | 284.5 g/mol |
| IUPAC name | (9Z,12Z)-9,10,12,13-tetradeuteriooctadeca-9,12-dienoic acid |
| InChIKey | OYHQOLUKZRVURQ-GPTDOFLBSA-N |
| SMILES | [2H]/C(=C(\[2H])/C/C(=C(/[2H])\CCCCCCCC(=O)O)/[2H])/CCCCC |
Computed by PubChem (NCBI)