Products 2135916-47-9
CAS 2135916-47-9 is the registry number for (9H-Fluoren-9-yl)methyl 3-(4-nitrophenoxy)propylcarbamate, N/A. Offered by: Chemat. Available pack sizes: 100mg.
9H-fluoren-9-ylmethyl N-[3-(4-nitrophenoxy)propyl]carbamate (CAS 2135916-47-9) is a chemical compound with the molecular formula C24H22N2O5 and a molecular weight of 418.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[3-(4-nitrophenoxy)propyl]carbamate. InChIKey: RBWWTWLTOLNDFZ-UHFFFAOYSA-N.
| Molecular formula | C24H22N2O5 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[3-(4-nitrophenoxy)propyl]carbamate |
| InChIKey | RBWWTWLTOLNDFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCOC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)