cas: 159790-81-5 — see every product listed under this CAS number, including other names
(9H-Fluoren-9-yl)methyl 4-aminobenzylcarbamate, 95%, 95% (CAS 159790-81-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RDW-100mg |
| cas | 159790-81-5 |
| size | 100mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 25g | 1778.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-[(4-aminophenyl)methyl]carbamate (CAS 159790-81-5) is a chemical compound with the molecular formula C22H20N2O2 and a molecular weight of 344.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(4-aminophenyl)methyl]carbamate. InChIKey: ZJXNVHARJJXJOW-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(4-aminophenyl)methyl]carbamate |
| InChIKey | ZJXNVHARJJXJOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)