CAS 17234-76-3 appears in our catalog under these names: Mecobalamin Impurity 3, N,N'-(4,5-Dimethyl-1,2-phenylene)dibenzamide, 98%, Methylcobalamin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-benzamido-4,5-dimethylphenyl)benzamide (CAS 17234-76-3) is a chemical compound with the molecular formula C22H20N2O2 and a molecular weight of 344.4 g/mol. IUPAC name: N-(2-benzamido-4,5-dimethylphenyl)benzamide. InChIKey: BFSRWKHHVHXWMN-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | N-(2-benzamido-4,5-dimethylphenyl)benzamide |
| InChIKey | BFSRWKHHVHXWMN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)NC(=O)C2=CC=CC=C2)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)