cas: 7459-33-8 — see every product listed under this CAS number, including other names
(9Z,12Z)-Octadeca-9,12-dienoyl chloride (CAS 7459-33-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F477413-1G |
| cas | 7459-33-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 471.73 Pln |
| delivery time | 3-4 weeks |
|---|
(9Z,12Z)-octadeca-9,12-dienoyl chloride (CAS 7459-33-8) is a chemical compound with the molecular formula C18H31ClO and a molecular weight of 298.9 g/mol. IUPAC name: (9Z,12Z)-octadeca-9,12-dienoyl chloride. InChIKey: FBWMYSQUTZRHAT-HZJYTTRNSA-N.
| Molecular formula | C18H31ClO |
|---|---|
| Molecular weight | 298.9 g/mol |
| IUPAC name | (9Z,12Z)-octadeca-9,12-dienoyl chloride |
| InChIKey | FBWMYSQUTZRHAT-HZJYTTRNSA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)Cl |
Computed by PubChem (NCBI)