cas: 132431-09-5 — see every product listed under this CAS number, including other names
(Cbz-4-aminomethyl)piperidine 98% HPLC (CAS 132431-09-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A143855-250mg |
| cas | 132431-09-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 375.94 Pln | |
| Ambeed | 5g | 1293.75 Pln | |
| Ambeed | 25g | 4002.69 Pln |
| purity | 98% HPLC |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A143855 |
Benzyl N-(piperidin-4-ylmethyl)carbamate (CAS 132431-09-5) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-(piperidin-4-ylmethyl)carbamate. InChIKey: BZHPVEHRXAKHMV-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-(piperidin-4-ylmethyl)carbamate |
| InChIKey | BZHPVEHRXAKHMV-UHFFFAOYSA-N |
| SMILES | C1CNCCC1CNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)