cas: 5293-84-5 — see every product listed under this CAS number, including other names
(Chloromethyl)triphenylphosphonium Chloride, 98%, 98% (CAS 5293-84-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0GE-1g |
| cas | 5293-84-5 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 246.80 Pln | |
| Chemat | 100g | 794.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Chloromethyl(triphenyl)phosphanium chloride (CAS 5293-84-5) is a chemical compound with the molecular formula C19H17Cl2P and a molecular weight of 347.2 g/mol. IUPAC name: chloromethyl(triphenyl)phosphanium chloride. InChIKey: SXYFAZGVNNYGJQ-UHFFFAOYSA-M.
| Molecular formula | C19H17Cl2P |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | chloromethyl(triphenyl)phosphanium chloride |
| InChIKey | SXYFAZGVNNYGJQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CCl)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-] |
Computed by PubChem (NCBI)