CAS 5293-84-5 appears in our catalog under these names: (Chloromethyl)triphenylphosphonium chloride, 98%, (Chloromethyl)triphenylphosphonium Chloride, Chloromethyltriphenylphosphonium chloride/ 98%, (Chloromethyl)triphenylphosphonium chloride, (Chloromethyl)triphenylphosphonium Chloride, >98.0%(HPLC)(T). Offered by: Combi-blocks, TRC, Chemat, GLPBio, TCI. Available pack sizes: 25g, 1g, 5g, 100g, 10g, 2,5g, 500g.
Chloromethyl(triphenyl)phosphanium chloride (CAS 5293-84-5) is a chemical compound with the molecular formula C19H17Cl2P and a molecular weight of 347.2 g/mol. IUPAC name: chloromethyl(triphenyl)phosphanium chloride. InChIKey: SXYFAZGVNNYGJQ-UHFFFAOYSA-M.
| Molecular formula | C19H17Cl2P |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | chloromethyl(triphenyl)phosphanium chloride |
| InChIKey | SXYFAZGVNNYGJQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CCl)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-] |
Computed by PubChem (NCBI)