cas: 63517-29-3 — see every product listed under this CAS number, including other names
(Diethylamino)difluorosulfonium tetrafluoroborate 97% (CAS 63517-29-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A787473-5g |
| cas | 63517-29-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 570.62 Pln | |
| Ambeed | 500g | 1827.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A787473 |
Diethylamino(difluoro)sulfanium tetrafluoroborate (CAS 63517-29-3) is a chemical compound with the molecular formula C4H10BF6NS and a molecular weight of 229.00 g/mol. IUPAC name: diethylamino(difluoro)sulfanium tetrafluoroborate. InChIKey: YLNKFQWRRIXZPJ-UHFFFAOYSA-N.
| Molecular formula | C4H10BF6NS |
|---|---|
| Molecular weight | 229.00 g/mol |
| IUPAC name | diethylamino(difluoro)sulfanium tetrafluoroborate |
| InChIKey | YLNKFQWRRIXZPJ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCN(CC)[S+](F)F |
Computed by PubChem (NCBI)