CAS 63517-29-3 appears in our catalog under these names: (Diethylamino)difluorosulfonium tetrafluoroborate, 95%, XtalFluor–E, XtalFluor-E, (Diethylamino)difluorosulfonium tetrafluoroborate 97%, XTALFLUOR-E(R). Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 1g, 100g, 5g, 1kg, 0,5kg, 2kg, 10kg.
Diethylamino(difluoro)sulfanium tetrafluoroborate (CAS 63517-29-3) is a chemical compound with the molecular formula C4H10BF6NS and a molecular weight of 229.00 g/mol. IUPAC name: diethylamino(difluoro)sulfanium tetrafluoroborate. InChIKey: YLNKFQWRRIXZPJ-UHFFFAOYSA-N.
| Molecular formula | C4H10BF6NS |
|---|---|
| Molecular weight | 229.00 g/mol |
| IUPAC name | diethylamino(difluoro)sulfanium tetrafluoroborate |
| InChIKey | YLNKFQWRRIXZPJ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCN(CC)[S+](F)F |
Computed by PubChem (NCBI)