cas: 380430-58-0 — see every product listed under this CAS number, including other names
(E)-(4-(3-Methoxy-3-oxoprop-1-en-1-yl)phenyl)boronic acid, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 380430-58-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187GC-100mg |
| cas | 380430-58-0 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 376.40 Pln | |
| Chemat | 5g | 1605.20 Pln |
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid (CAS 380430-58-0) is a chemical compound with the molecular formula C10H11BO4 and a molecular weight of 206.00 g/mol. IUPAC name: [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid. InChIKey: BIKAXBPCHWDATP-QPJJXVBHSA-N.
| Molecular formula | C10H11BO4 |
|---|---|
| Molecular weight | 206.00 g/mol |
| IUPAC name | [4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid |
| InChIKey | BIKAXBPCHWDATP-QPJJXVBHSA-N |
| SMILES | B(C1=CC=C(C=C1)/C=C/C(=O)OC)(O)O |
Computed by PubChem (NCBI)