Products 380430-59-1

CAS 380430-59-1 is the registry number for 3-(E-3-Methoxy-3-oxo-1-propen-1-yl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[3-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid (CAS 380430-59-1) is a chemical compound with the molecular formula C10H11BO4 and a molecular weight of 206.00 g/mol. IUPAC name: [3-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid. InChIKey: DZTWTEGVKAHSGN-AATRIKPKSA-N.

Identity
Molecular formulaC10H11BO4
Molecular weight206.00 g/mol
IUPAC name[3-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]boronic acid
InChIKeyDZTWTEGVKAHSGN-AATRIKPKSA-N
SMILESB(C1=CC(=CC=C1)/C=C/C(=O)OC)(O)O

Computed by PubChem (NCBI)