Products 366014-13-3
CAS 366014-13-3 is the registry number for (E)-1,1,1-Trifluoro-3-methyl-4-phenylbut-3-en-2-one, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(E)-1,1,1-trifluoro-3-methyl-4-phenylbut-3-en-2-one (CAS 366014-13-3) is a chemical compound with the molecular formula C11H9F3O and a molecular weight of 214.18 g/mol. IUPAC name: (E)-1,1,1-trifluoro-3-methyl-4-phenylbut-3-en-2-one. InChIKey: KUKWSXMBLHGBIG-BQYQJAHWSA-N.
| Molecular formula | C11H9F3O |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | (E)-1,1,1-trifluoro-3-methyl-4-phenylbut-3-en-2-one |
| InChIKey | KUKWSXMBLHGBIG-BQYQJAHWSA-N |
| SMILES | C/C(=C\C1=CC=CC=C1)/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)