CAS 1080636-43-6 appears in our catalog under these names: 3-[4-(Trifluoromethyl)phenyl]cyclobutan-1-one, 95%, 3-(4-(Trifluoromethyl)phenyl)cyclobutanone, 98%, 3-(4-(Trifluoromethyl)phenyl)cyclobutan-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
3-[4-(trifluoromethyl)phenyl]cyclobutan-1-one (CAS 1080636-43-6) is a chemical compound with the molecular formula C11H9F3O and a molecular weight of 214.18 g/mol. IUPAC name: 3-[4-(trifluoromethyl)phenyl]cyclobutan-1-one. InChIKey: HPWSYVDXXWRSJM-UHFFFAOYSA-N.
| Molecular formula | C11H9F3O |
|---|---|
| Molecular weight | 214.18 g/mol |
| IUPAC name | 3-[4-(trifluoromethyl)phenyl]cyclobutan-1-one |
| InChIKey | HPWSYVDXXWRSJM-UHFFFAOYSA-N |
| SMILES | C1C(CC1=O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)