cas: 17224-17-8 — see every product listed under this CAS number, including other names
(E)-1-(4-((4-Ethoxybenzylidene)amino)phenyl)ethan-1-one, 98% (CAS 17224-17-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F624450-100MG |
| cas | 17224-17-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 284.29 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 851.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[4-[(4-ethoxyphenyl)methylideneamino]phenyl]ethanone (CAS 17224-17-8) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: 1-[4-[(4-ethoxyphenyl)methylideneamino]phenyl]ethanone. InChIKey: HCDYNBNSFSMUIM-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 1-[4-[(4-ethoxyphenyl)methylideneamino]phenyl]ethanone |
| InChIKey | HCDYNBNSFSMUIM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C=NC2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)