CAS 346577-65-9 appears in our catalog under these names: 1-Benzyl-5-ethoxy-1,3-dihydro-indol-2-one, 95%, 1-Benzyl-5-ethoxyindolin-2-one, 95+%, 1–benzyl–5–ethoxy–3H–indol–2–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-benzyl-5-ethoxy-3H-indol-2-one (CAS 346577-65-9) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: 1-benzyl-5-ethoxy-3H-indol-2-one. InChIKey: DWWBDFKXPPTLRW-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 1-benzyl-5-ethoxy-3H-indol-2-one |
| InChIKey | DWWBDFKXPPTLRW-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)N(C(=O)C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)