(E)-1-Iodo-4-(2-nitrovinyl)benzene, 95%
cas: 5153-72-0 — see every product listed under this CAS number, including other names
(E)-1-Iodo-4-(2-nitrovinyl)benzene, 95% (CAS 5153-72-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F959468-250MG |
| cas | 5153-72-0 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 492.55 Pln | |
| Fluorochem | 1g | 1169.40 Pln | |
| Fluorochem | 5g | 3798.68 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1132.44 Pln | |
| Ambeed | 5g | 3719.00 Pln | |
| BLDpharm | 250mg | 458.75 Pln | |
| BLDpharm | 1g | 1097.42 Pln | |
| BLDpharm | 5g | 3596.54 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 2272.40 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-iodo-4-[(E)-2-nitroethenyl]benzene (CAS 5153-72-0) is a chemical compound with the molecular formula C8H6INO2 and a molecular weight of 275.04 g/mol. IUPAC name: 1-iodo-4-[(E)-2-nitroethenyl]benzene. InChIKey: PNICDNUSJRQMNP-AATRIKPKSA-N.
| Molecular formula | C8H6INO2 |
|---|---|
| Molecular weight | 275.04 g/mol |
| IUPAC name | 1-iodo-4-[(E)-2-nitroethenyl]benzene |
| InChIKey | PNICDNUSJRQMNP-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/[N+](=O)[O-])I |
Computed by PubChem (NCBI)