CAS 874840-87-6 appears in our catalog under these names: 7-Iodo-2H-1,4-benzoxazin-3(4H)-one, 95%, 95%, 7-Iodo-2H-benzo[b][1,4]oxazin-3(4H)-one, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-iodo-4H-1,4-benzoxazin-3-one (CAS 874840-87-6) is a chemical compound with the molecular formula C8H6INO2 and a molecular weight of 275.04 g/mol. IUPAC name: 7-iodo-4H-1,4-benzoxazin-3-one. InChIKey: RNGWLYQJCXPBKZ-UHFFFAOYSA-N.
| Molecular formula | C8H6INO2 |
|---|---|
| Molecular weight | 275.04 g/mol |
| IUPAC name | 7-iodo-4H-1,4-benzoxazin-3-one |
| InChIKey | RNGWLYQJCXPBKZ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C=C2)I |
Computed by PubChem (NCBI)