cas: 136164-66-4 — see every product listed under this CAS number, including other names
(E)-2-((4,5-Dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylene)undecanoic acid, 98%, 98% (CAS 136164-66-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110YZ5-1mg |
| cas | 136164-66-4 |
| size | 1mg |
| availability | 0.25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 155.60 Pln | |
| Chemat | 5mg | 323.60 Pln | |
| Chemat | 10mg | 506.00 Pln | |
| Chemat | 25mg | 818.00 Pln | |
| Chemat | 50mg | 1350.80 Pln | |
| Chemat | 100mg | 2459.60 Pln | |
| Chemat | 250mg | 4139.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanoic acid (CAS 136164-66-4) is a chemical compound with the molecular formula C21H30O6 and a molecular weight of 378.5 g/mol. IUPAC name: (2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanoic acid. InChIKey: AALSSIXXBDPENJ-FYWRMAATSA-N.
| Molecular formula | C21H30O6 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | (2E)-2-[(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)methylidene]undecanoic acid |
| InChIKey | AALSSIXXBDPENJ-FYWRMAATSA-N |
| SMILES | CCCCCCCCC/C(=C\C1=C(C(=O)C(=C(C1=O)OC)OC)C)/C(=O)O |
Computed by PubChem (NCBI)