CAS 1726-23-4 appears in our catalog under these names: 1,2,4-Benzenetricarboxylic acid tributyl ester, 98%, Tributyl Trimellitate, Tributyl Trimellitate, Tributyl Trimellitate, >98.0%(GC), Tributyl benzene-1,2,4-tricarboxylate 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 2,5g, 250mg, 500mg, 25ml.
Tributyl benzene-1,2,4-tricarboxylate (CAS 1726-23-4) is a chemical compound with the molecular formula C21H30O6 and a molecular weight of 378.5 g/mol. IUPAC name: tributyl benzene-1,2,4-tricarboxylate. InChIKey: RJIFVNWOLLIBJV-UHFFFAOYSA-N.
| Molecular formula | C21H30O6 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | tributyl benzene-1,2,4-tricarboxylate |
| InChIKey | RJIFVNWOLLIBJV-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=CC(=C(C=C1)C(=O)OCCCC)C(=O)OCCCC |
Computed by PubChem (NCBI)