cas: 14393-45-4 — see every product listed under this CAS number, including other names
(E)-3-(2,6,6-Trimethylcyclohex-1-en-1-yl)acrylic acid, 98% (CAS 14393-45-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A754350-1g |
| cas | 14393-45-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6417.25 Pln | |
| AmBeed | 5g | 19111.75 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid (CAS 14393-45-4) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid. InChIKey: RCVGWZAQWMJQHG-VOTSOKGWSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | (E)-3-(2,6,6-trimethylcyclohexen-1-yl)prop-2-enoic acid |
| InChIKey | RCVGWZAQWMJQHG-VOTSOKGWSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=O)O |
Computed by PubChem (NCBI)