cas: 18944-77-9 — see every product listed under this CAS number, including other names
(E)-3-(2-Fluorophenyl)acrylic acid, 98% (CAS 18944-77-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552208-5G |
| cas | 18944-77-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 25g | 237.43 Pln | |
| Fluorochem | 100g | 674.78 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(E)-3-(2-fluorophenyl)prop-2-enoic acid (CAS 18944-77-9) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: (E)-3-(2-fluorophenyl)prop-2-enoic acid. InChIKey: IOUDZAFBPDDAMK-AATRIKPKSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (E)-3-(2-fluorophenyl)prop-2-enoic acid |
| InChIKey | IOUDZAFBPDDAMK-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)