(E)-3-(2-Fluorophenyl)acrylic acid, 98%
cas: 18944-77-9 — see every product listed under this CAS number, including other names
(E)-3-(2-Fluorophenyl)acrylic acid, 98% (CAS 18944-77-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A523000-5g |
| cas | 18944-77-9 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 259.12 Pln | |
| Ambeed | 100g | 709.69 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 371.60 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 25g | 275.48 Pln | |
| BLDpharm | 100g | 758.65 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 25g | 247.85 Pln | |
| Fluorochem | 100g | 711.23 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(E)-3-(2-fluorophenyl)prop-2-enoic acid (CAS 18944-77-9) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: (E)-3-(2-fluorophenyl)prop-2-enoic acid. InChIKey: IOUDZAFBPDDAMK-AATRIKPKSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (E)-3-(2-fluorophenyl)prop-2-enoic acid |
| InChIKey | IOUDZAFBPDDAMK-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2-Fluorocinnamic acid, ortho-Fluorocinnamate, Cinnamic acid, o-fluoro-, (E)-3-(2-Fluorophenyl)acrylic acid, o-Fluorocinnamic acid, (2E)-3-(2-fluorophenyl)prop-2-enoic acid, (E)-3-(2-fluorophenyl)prop-2-enoic acid, 2-Propenoic acid, 3-(2-fluorophenyl)-, 3-(2-Fluorophenyl)acrylic acid, 3-(2-fluoro-phenyl)-acrylic acid