CAS 451-69-4 appears in our catalog under these names: 2-Fluorocinnamic Acid, 2–Fluorocinnamic acid, 2-Fluorocinnamic acid, 98%, 3-(2-Fluorophenyl)acrylic acid, 98.5% (predominantly trans), 98.5% (predominantly trans), 2-Fluorocinnamic acid, 98.5% (predominantly trans). Offered by: TRC, GLPBio, Thermo Scientific (Acros), Sigma-Aldrich, Chemat. Available pack sizes: 10g, 50g, 5g, 100g, 25g, 1g.
(E)-3-(2-fluorophenyl)prop-2-enoic acid (CAS 451-69-4) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: (E)-3-(2-fluorophenyl)prop-2-enoic acid. InChIKey: IOUDZAFBPDDAMK-AATRIKPKSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (E)-3-(2-fluorophenyl)prop-2-enoic acid |
| InChIKey | IOUDZAFBPDDAMK-AATRIKPKSA-N |
| SMILES | C1=CC=C(C(=C1)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)