cas: 262268-58-6 — see every product listed under this CAS number, including other names
(E)-3-(3-(Trifluoromethyl)phenyl)acrylaldehyde 98% (CAS 262268-58-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A406372-1g |
| cas | 262268-58-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 25g | 1188.06 Pln | |
| Ambeed | 100g | 4169.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A406372 |
(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enal (CAS 262268-58-6) is a chemical compound with the molecular formula C10H7F3O and a molecular weight of 200.16 g/mol. IUPAC name: (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enal. InChIKey: JMKMLIWUWJNVIG-DUXPYHPUSA-N.
| Molecular formula | C10H7F3O |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | (E)-3-[3-(trifluoromethyl)phenyl]prop-2-enal |
| InChIKey | JMKMLIWUWJNVIG-DUXPYHPUSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)/C=C/C=O |
Computed by PubChem (NCBI)