CAS 1003048-68-7 appears in our catalog under these names: 7-(Trifluoromethyl)-2,3-dihydro-1h-inden-1-one, 95%, 7–(Trifluoromethyl)–2,3–dihydro–1H–inden–1–one, 7-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-one 95%, 7-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-one, 95%, 95%, 7-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
7-(trifluoromethyl)-2,3-dihydroinden-1-one (CAS 1003048-68-7) is a chemical compound with the molecular formula C10H7F3O and a molecular weight of 200.16 g/mol. IUPAC name: 7-(trifluoromethyl)-2,3-dihydroinden-1-one. InChIKey: RHHGHWBHOQXKNZ-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O |
|---|---|
| Molecular weight | 200.16 g/mol |
| IUPAC name | 7-(trifluoromethyl)-2,3-dihydroinden-1-one |
| InChIKey | RHHGHWBHOQXKNZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)