cas: 106129-86-6 — see every product listed under this CAS number, including other names
(E)-3-(Dimethylamino)-1-(2-hydroxyphenyl)prop-2-en-1-one 96% (CAS 106129-86-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193530-250mg |
| cas | 106129-86-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1132.44 Pln | |
| Ambeed | 5g | 3785.75 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A193530 |
(E)-3-(dimethylamino)-1-(2-hydroxyphenyl)prop-2-en-1-one (CAS 106129-86-6) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-(2-hydroxyphenyl)prop-2-en-1-one. InChIKey: SVBCOAAIOJDZNC-BQYQJAHWSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-(2-hydroxyphenyl)prop-2-en-1-one |
| InChIKey | SVBCOAAIOJDZNC-BQYQJAHWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC=CC=C1O |
Computed by PubChem (NCBI)