Products 264903-53-9
CAS 264903-53-9 appears in our catalog under these names: D-Styrylalanine, 98%, (R)–2–Amino–5–phenylpent–4–enoic acid, D-Styrylalanine, 97%, 97%, (R)-2-Amino-5-phenylpent-4-enoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 10g, 25g, 1g, 100mg.
(E,2R)-2-amino-5-phenylpent-4-enoic acid (CAS 264903-53-9) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (E,2R)-2-amino-5-phenylpent-4-enoic acid. InChIKey: MCGSKGBMVBECNS-LJJSCBMDSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (E,2R)-2-amino-5-phenylpent-4-enoic acid |
| InChIKey | MCGSKGBMVBECNS-LJJSCBMDSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
D-Styrylalanine, (R)-2-Amino-5-phenylpent-4-enoic acid, (E)-D-Styrylalanine, 4-Pentenoic acid, 2-amino-5-phenyl-, (2R)-, (E,2R)-2-amino-5-phenylpent-4-enoic acid, H-D-Ala(Styryl)-OH, H-D-Styryl-Ala-OH, (2R)-2-amino-5-phenyl-4-pentenoic acid, D-styrylalanine, AldrichCPR, D-Styrylalanine (H-D-Ala(Styr)-OH)