cas: 642066-70-4 — see every product listed under this CAS number, including other names
(E)-4,4,5,5-Tetramethyl-2-(3-((tetrahydro-2H-pyran-2-yl)oxy)prop-1-en-1-yl)-1,3,2-dioxaborolane 95% mix TBC as stabilizer (CAS 642066-70-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A630869-250mg |
| cas | 642066-70-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 95% mix TBC as stabilizer |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A630869 |
4,4,5,5-tetramethyl-2-[(E)-3-(oxan-2-yloxy)prop-1-enyl]-1,3,2-dioxaborolane (CAS 642066-70-4) is a chemical compound with the molecular formula C14H25BO4 and a molecular weight of 268.16 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-3-(oxan-2-yloxy)prop-1-enyl]-1,3,2-dioxaborolane. InChIKey: MHSOBXCZCRNELG-VQHVLOKHSA-N.
| Molecular formula | C14H25BO4 |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-3-(oxan-2-yloxy)prop-1-enyl]-1,3,2-dioxaborolane |
| InChIKey | MHSOBXCZCRNELG-VQHVLOKHSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/COC2CCCCO2 |
Computed by PubChem (NCBI)