cas: 642066-70-4 — see every product listed under this CAS number, including other names
(E)-4,4,5,5-Tetramethyl-2-(3-((tetrahydro-2H-pyran-2-yl)oxy)prop-1-en-1-yl)-1,3,2-dioxaborolane, 95%(stabilized with TBC), 95%(stabilized with TBC) (CAS 642066-70-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C1Q-100mg |
| cas | 642066-70-4 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 95%(stabilized with TBC) |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-[(E)-3-(oxan-2-yloxy)prop-1-enyl]-1,3,2-dioxaborolane (CAS 642066-70-4) is a chemical compound with the molecular formula C14H25BO4 and a molecular weight of 268.16 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-3-(oxan-2-yloxy)prop-1-enyl]-1,3,2-dioxaborolane. InChIKey: MHSOBXCZCRNELG-VQHVLOKHSA-N.
| Molecular formula | C14H25BO4 |
|---|---|
| Molecular weight | 268.16 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-3-(oxan-2-yloxy)prop-1-enyl]-1,3,2-dioxaborolane |
| InChIKey | MHSOBXCZCRNELG-VQHVLOKHSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/COC2CCCCO2 |
Computed by PubChem (NCBI)