cas: 155270-98-7 — see every product listed under this CAS number, including other names
(E)-8-(3,4-Dimethoxystyryl)-1,3-diethyl-1H-purine-2,6(3H,7H)-dione, 95+% (CAS 155270-98-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A790732-250mg |
| cas | 155270-98-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 481.62 Pln | |
| Ambeed | 5g | 1499.56 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 1557.20 Pln | |
| BLDpharm | 250mg | 236.61 Pln | |
| BLDpharm | 1g | 514.29 Pln | |
| BLDpharm | 5g | 1608.35 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3-diethyl-7H-purine-2,6-dione (CAS 155270-98-7) is a chemical compound with the molecular formula C19H22N4O4 and a molecular weight of 370.4 g/mol. IUPAC name: 8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3-diethyl-7H-purine-2,6-dione. InChIKey: IZFYJVITWLNDJA-CSKARUKUSA-N.
| Molecular formula | C19H22N4O4 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 8-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1,3-diethyl-7H-purine-2,6-dione |
| InChIKey | IZFYJVITWLNDJA-CSKARUKUSA-N |
| SMILES | CCN1C2=C(C(=O)N(C1=O)CC)NC(=N2)/C=C/C3=CC(=C(C=C3)OC)OC |
Computed by PubChem (NCBI)