CAS 160434-48-0 appears in our catalog under these names: 4-Desmethyl Istradefylline, Istradefylline Impurity 14. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, Get quote.
1,3-diethyl-8-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-7-methylpurine-2,6-dione (CAS 160434-48-0) is a chemical compound with the molecular formula C19H22N4O4 and a molecular weight of 370.4 g/mol. IUPAC name: 1,3-diethyl-8-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-7-methylpurine-2,6-dione. InChIKey: OHGCYFOMTIEDMR-CSKARUKUSA-N.
| Molecular formula | C19H22N4O4 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 1,3-diethyl-8-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-7-methylpurine-2,6-dione |
| InChIKey | OHGCYFOMTIEDMR-CSKARUKUSA-N |
| SMILES | CCN1C2=C(C(=O)N(C1=O)CC)N(C(=N2)/C=C/C3=CC(=C(C=C3)O)OC)C |
Computed by PubChem (NCBI)