cas: 480425-30-7 — see every product listed under this CAS number, including other names
(E)-tert-Butyldimethyl((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-yl)oxy)silane, 95%, 95% (CAS 480425-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C1Y-100mg |
| cas | 480425-30-7 |
| size | 100mg |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 500mg | 155.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 774.80 Pln | |
| Chemat | 25g | 3611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl-dimethyl-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoxy]silane (CAS 480425-30-7) is a chemical compound with the molecular formula C16H33BO3Si and a molecular weight of 312.3 g/mol. IUPAC name: tert-butyl-dimethyl-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoxy]silane. InChIKey: ODTSJDLTXNDTBB-ZRDIBKRKSA-N.
| Molecular formula | C16H33BO3Si |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | tert-butyl-dimethyl-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoxy]silane |
| InChIKey | ODTSJDLTXNDTBB-ZRDIBKRKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)