cas: 480425-30-7 — see every product listed under this CAS number, including other names
tert-Butyldimethyl((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-en-1-yl)oxy)silane, 97% (CAS 480425-30-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218551-1G |
| cas | 480425-30-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1039.24 Pln | |
| Fluorochem | 25g | 4059.01 Pln | |
| Fluorochem | 100g | 13258.89 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl-dimethyl-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoxy]silane (CAS 480425-30-7) is a chemical compound with the molecular formula C16H33BO3Si and a molecular weight of 312.3 g/mol. IUPAC name: tert-butyl-dimethyl-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoxy]silane. InChIKey: ODTSJDLTXNDTBB-ZRDIBKRKSA-N.
| Molecular formula | C16H33BO3Si |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | tert-butyl-dimethyl-[(E)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-3-enoxy]silane |
| InChIKey | ODTSJDLTXNDTBB-ZRDIBKRKSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)