CAS 32004-67-4 appears in our catalog under these names: (E/Z)-Sulindac sulfide, 98%, (E/Z)–Sulindac sulfide, Sulindac sulfide , Sulindac Sulfide, >98.0%(HPLC), Sulindac sulphide. Offered by: AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 250mg, 100mg, 25mg, 50mg, 0,5g, 0,25g, 1g, 5g.
2-[6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetic acid (CAS 32004-67-4) is a chemical compound with the molecular formula C20H17FO2S and a molecular weight of 340.4 g/mol. IUPAC name: 2-[6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetic acid. InChIKey: LFWHFZJPXXOYNR-UHFFFAOYSA-N.
| Molecular formula | C20H17FO2S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-[6-fluoro-2-methyl-3-[(4-methylsulfanylphenyl)methylidene]inden-1-yl]acetic acid |
| InChIKey | LFWHFZJPXXOYNR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C1=CC3=CC=C(C=C3)SC)C=CC(=C2)F)CC(=O)O |
Computed by PubChem (NCBI)