cas: 19014-29-0 — see every product listed under this CAS number, including other names
(Oxybis(4,1-phenylene))diboronic acid 95% (CAS 19014-29-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A592323-50mg |
| cas | 19014-29-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 375.94 Pln | |
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1905.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A592323 |
[4-(4-boronophenoxy)phenyl]boronic acid (CAS 19014-29-0) is a chemical compound with the molecular formula C12H12B2O5 and a molecular weight of 257.8 g/mol. IUPAC name: [4-(4-boronophenoxy)phenyl]boronic acid. InChIKey: DFPCWEXYGPRULG-UHFFFAOYSA-N.
| Molecular formula | C12H12B2O5 |
|---|---|
| Molecular weight | 257.8 g/mol |
| IUPAC name | [4-(4-boronophenoxy)phenyl]boronic acid |
| InChIKey | DFPCWEXYGPRULG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC=C(C=C2)B(O)O)(O)O |
Computed by PubChem (NCBI)