cas: 19014-29-0 — see every product listed under this CAS number, including other names
4,4'-Oxybis(1,4-phenylene)diboronic acid, 95%, 95% (CAS 19014-29-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113EDS-250mg |
| cas | 19014-29-0 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 506.00 Pln | |
| Chemat | 50mg | 232.40 Pln | |
| Chemat | 100mg | 280.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(4-boronophenoxy)phenyl]boronic acid (CAS 19014-29-0) is a chemical compound with the molecular formula C12H12B2O5 and a molecular weight of 257.8 g/mol. IUPAC name: [4-(4-boronophenoxy)phenyl]boronic acid. InChIKey: DFPCWEXYGPRULG-UHFFFAOYSA-N.
| Molecular formula | C12H12B2O5 |
|---|---|
| Molecular weight | 257.8 g/mol |
| IUPAC name | [4-(4-boronophenoxy)phenyl]boronic acid |
| InChIKey | DFPCWEXYGPRULG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OC2=CC=C(C=C2)B(O)O)(O)O |
Computed by PubChem (NCBI)