CAS 18052-92-1 appears in our catalog under these names: (Methacryloxymethyl)phenyldimethylsilane, 95%, (Dimethyl(phenyl)silyl)methyl methacrylate, (Phenyldimethylsilyl)methyl methacrylate, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g.
[dimethyl(phenyl)silyl]methyl 2-methylprop-2-enoate (CAS 18052-92-1) is a chemical compound with the molecular formula C13H18O2Si and a molecular weight of 234.37 g/mol. IUPAC name: [dimethyl(phenyl)silyl]methyl 2-methylprop-2-enoate. InChIKey: RKFUZDIZLQCJKA-UHFFFAOYSA-N.
| Molecular formula | C13H18O2Si |
|---|---|
| Molecular weight | 234.37 g/mol |
| IUPAC name | [dimethyl(phenyl)silyl]methyl 2-methylprop-2-enoate |
| InChIKey | RKFUZDIZLQCJKA-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC[Si](C)(C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)