CAS 400608-30-2 is the registry number for 1-[(Trimethylsilyl)ethynyl]-3,5-dimethoxybenzene, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(3,5-dimethoxyphenyl)ethynyl-trimethylsilane (CAS 400608-30-2) is a chemical compound with the molecular formula C13H18O2Si and a molecular weight of 234.37 g/mol. IUPAC name: 2-(3,5-dimethoxyphenyl)ethynyl-trimethylsilane. InChIKey: DGSBDARVIGVKSP-UHFFFAOYSA-N.
| Molecular formula | C13H18O2Si |
|---|---|
| Molecular weight | 234.37 g/mol |
| IUPAC name | 2-(3,5-dimethoxyphenyl)ethynyl-trimethylsilane |
| InChIKey | DGSBDARVIGVKSP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C#C[Si](C)(C)C)OC |
Computed by PubChem (NCBI)