cas: 623586-00-5 — see every product listed under this CAS number, including other names
(R)–Benzyl 3–methylpiperazine–1–carboxylate (CAS 623586-00-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD20714-10g |
| cas | 623586-00-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 2656.46 Pln | |
| GLPBio | 1g | 774.90 Pln | |
| GLPBio | 250mg | 587.68 Pln | |
| GLPBio | 25g | 5474.12 Pln | |
| GLPBio | 5g | 1785.89 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl (3R)-3-methylpiperazine-1-carboxylate (CAS 623586-00-5) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl (3R)-3-methylpiperazine-1-carboxylate. InChIKey: JRPIQMPFKMFAOX-LLVKDONJSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl (3R)-3-methylpiperazine-1-carboxylate |
| InChIKey | JRPIQMPFKMFAOX-LLVKDONJSA-N |
| SMILES | C[C@@H]1CN(CCN1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)