Products 13725-02-5
CAS 13725-02-5 appears in our catalog under these names: 3-Amino-1-benzyl-piperidine-3-carboxylic acid, 95%, 3-Amino-1-benzylpiperidine-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg.
3-amino-1-benzylpiperidine-3-carboxylic acid (CAS 13725-02-5) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: 3-amino-1-benzylpiperidine-3-carboxylic acid. InChIKey: SIHICTGIUNQECV-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 3-amino-1-benzylpiperidine-3-carboxylic acid |
| InChIKey | SIHICTGIUNQECV-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)(C(=O)O)N |
Computed by PubChem (NCBI)