cas: 228244-20-0 — see every product listed under this CAS number, including other names
(R)-(+)-1-Boc-2-pyrrolidinecarbonitrile, 97%, 97% (CAS 228244-20-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C5P-250mg |
| cas | 228244-20-0 |
| size | 250mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 25g | 1091.60 Pln | |
| Chemat | 10g | 578.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2R)-2-cyanopyrrolidine-1-carboxylate (CAS 228244-20-0) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: tert-butyl (2R)-2-cyanopyrrolidine-1-carboxylate. InChIKey: MDMSZBHMBCNYNO-MRVPVSSYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | tert-butyl (2R)-2-cyanopyrrolidine-1-carboxylate |
| InChIKey | MDMSZBHMBCNYNO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1C#N |
Computed by PubChem (NCBI)