CAS 50920-48-4 is the registry number for Ethyl 1-isopropyl-5-methyl-1h-pyrazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Ethyl 5-methyl-1-propan-2-ylpyrazole-3-carboxylate (CAS 50920-48-4) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: ethyl 5-methyl-1-propan-2-ylpyrazole-3-carboxylate. InChIKey: XOJOQIUVANMZEP-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | ethyl 5-methyl-1-propan-2-ylpyrazole-3-carboxylate |
| InChIKey | XOJOQIUVANMZEP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN(C(=C1)C)C(C)C |
Computed by PubChem (NCBI)