cas: 101376-26-5 — see every product listed under this CAS number, including other names
(R)-(4-Benzylmorpholin-3-yl)methanol 95% (CAS 101376-26-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A110843-250mg |
| cas | 101376-26-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 592.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A110843 |
[(3R)-4-benzylmorpholin-3-yl]methanol (CAS 101376-26-5) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: [(3R)-4-benzylmorpholin-3-yl]methanol. InChIKey: CPLXVETYMUMERG-GFCCVEGCSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | [(3R)-4-benzylmorpholin-3-yl]methanol |
| InChIKey | CPLXVETYMUMERG-GFCCVEGCSA-N |
| SMILES | C1COC[C@H](N1CC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)