CAS 28131-24-0 appears in our catalog under these names: tert-Butyl n-methyl-n-phenylcarbamate, 95%, tert-Butyl methyl(phenyl)carbamate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Tert-butyl N-methyl-N-phenylcarbamate (CAS 28131-24-0) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl N-methyl-N-phenylcarbamate. InChIKey: CKLRWXBZOPUEIE-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl N-methyl-N-phenylcarbamate |
| InChIKey | CKLRWXBZOPUEIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)